C28H33N3O5Si — CID 72711356
N-[1-[(2S,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-methoxy-2H-furan-2-yl]-2-oxopyrimidin-4-yl]acetamide (PubChem CID 72711356) has the molecular formula C28H33N3O5Si and a molecular weight of 519.67 g/mol. Its IUPAC name is N-[1-[(2S,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-methoxy-2H-furan-2-yl]-2-oxopyrimidin-4-yl]acetamide.
| Compound Name | N-[1-[(2S,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-methoxy-2H-furan-2-yl]-2-oxopyrimidin-4-yl]acetamide |
|---|---|
| PubChem CID | 72711356 |
| Molecular Formula | C28H33N3O5Si |
| Molecular Weight | 519.67 g/mol |
| Exact Mass | 519.22 |
| IUPAC Name | N-[1-[(2S,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-methoxy-2H-furan-2-yl]-2-oxopyrimidin-4-yl]acetamide |
| SMILES | CO[C@@]1(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C=C[C@@H](n2ccc(NC(C)=O)nc2=O)O1 |
| InChI | InChI=1S/C28H33N3O5Si/c1-21(32)29-24-17-19-31(26(33)30-24)25-16-18-28(34-5,36-25)20-35-37(27(2,3)4,22-12-8-6-9-13-22)23-14-10-7-11-15-23/h6-19,25H,20H2,1-5H3,(H,29,30,32,33)/t25-,28-/m0/s1 |
| InChIKey | UTRMHZYZBRGMNA-LSYYVWMOSA-N |
| XLogP | 3.21 |
| TPSA | 91.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.67 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|