C29H33N3O6Si — CID 10578522
[(2R,3R)-2-(4-acetamido-2-oxopyrimidin-1-yl)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,3-dihydrofuran-3-yl] acetate (PubChem CID 10578522) has the molecular formula C29H33N3O6Si and a molecular weight of 547.68 g/mol. Its IUPAC name is [(2R,3R)-2-(4-acetamido-2-oxopyrimidin-1-yl)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,3-dihydrofuran-3-yl] acetate.
| Compound Name | [(2R,3R)-2-(4-acetamido-2-oxopyrimidin-1-yl)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,3-dihydrofuran-3-yl] acetate |
|---|---|
| PubChem CID | 10578522 |
| Molecular Formula | C29H33N3O6Si |
| Molecular Weight | 547.68 g/mol |
| Exact Mass | 547.21 |
| IUPAC Name | [(2R,3R)-2-(4-acetamido-2-oxopyrimidin-1-yl)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,3-dihydrofuran-3-yl] acetate |
| SMILES | CC(=O)Nc1ccn([C@@H]2OC(CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)=C[C@H]2OC(C)=O)c(=O)n1 |
| InChI | InChI=1S/C29H33N3O6Si/c1-20(33)30-26-16-17-32(28(35)31-26)27-25(37-21(2)34)18-22(38-27)19-36-39(29(3,4)5,23-12-8-6-9-13-23)24-14-10-7-11-15-24/h6-18,25,27H,19H2,1-5H3,(H,30,31,33,35)/t25-,27-/m1/s1 |
| InChIKey | PFHBPFXHWUXGTP-XNMGPUDCSA-N |
| XLogP | 3.12 |
| TPSA | 108.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.68 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|