C29H36N6O5Si — CID 11628430
[(2R,3R,4R,5S)-2-(4-amino-2-oxopyrimidin-1-yl)-5-(azidomethyl)-4-[2-[tert-butyl(diphenyl)silyl]oxyethyl]oxolan-3-yl] acetate (PubChem CID 11628430) has the molecular formula C29H36N6O5Si and a molecular weight of 576.73 g/mol. Its IUPAC name is [(2R,3R,4R,5S)-2-(4-amino-2-oxopyrimidin-1-yl)-5-(azidomethyl)-4-[2-[tert-butyl(diphenyl)silyl]oxyethyl]oxolan-3-yl] acetate.
| Compound Name | [(2R,3R,4R,5S)-2-(4-amino-2-oxopyrimidin-1-yl)-5-(azidomethyl)-4-[2-[tert-butyl(diphenyl)silyl]oxyethyl]oxolan-3-yl] acetate |
|---|---|
| PubChem CID | 11628430 |
| Molecular Formula | C29H36N6O5Si |
| Molecular Weight | 576.73 g/mol |
| Exact Mass | 576.25 |
| IUPAC Name | [(2R,3R,4R,5S)-2-(4-amino-2-oxopyrimidin-1-yl)-5-(azidomethyl)-4-[2-[tert-butyl(diphenyl)silyl]oxyethyl]oxolan-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@H](CCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@@H](CN=[N+]=[N-])O[C@H]1n1ccc(N)nc1=O |
| InChI | InChI=1S/C29H36N6O5Si/c1-20(36)39-26-23(24(19-32-34-31)40-27(26)35-17-15-25(30)33-28(35)37)16-18-38-41(29(2,3)4,21-11-7-5-8-12-21)22-13-9-6-10-14-22/h5-15,17,23-24,26-27H,16,18-19H2,1-4H3,(H2,30,33,37)/t23-,24-,26-,27-/m1/s1 |
| InChIKey | WYMFZXWHJSIBIV-UDCKCYQBSA-N |
| XLogP | 3.55 |
| TPSA | 154.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.73 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|