C42H43N3O8Si — CID 59835259
[(2R,3R,4S,5R)-4-benzoyloxy-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-[2-oxo-4-(propanoylamino)pyrimidin-1-yl]oxolan-3-yl] benzoate (PubChem CID 59835259) has the molecular formula C42H43N3O8Si and a molecular weight of 745.91 g/mol. Its IUPAC name is [(2R,3R,4S,5R)-4-benzoyloxy-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-[2-oxo-4-(propanoylamino)pyrimidin-1-yl]oxolan-3-yl] benzoate.
| Compound Name | [(2R,3R,4S,5R)-4-benzoyloxy-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-[2-oxo-4-(propanoylamino)pyrimidin-1-yl]oxolan-3-yl] benzoate |
|---|---|
| PubChem CID | 59835259 |
| Molecular Formula | C42H43N3O8Si |
| Molecular Weight | 745.91 g/mol |
| Exact Mass | 745.28 |
| IUPAC Name | [(2R,3R,4S,5R)-4-benzoyloxy-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-[2-oxo-4-(propanoylamino)pyrimidin-1-yl]oxolan-3-yl] benzoate |
| SMILES | CCC(=O)Nc1ccn([C@@H]2O[C@H](CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)[C@@H](OC(=O)c3ccccc3)[C@@H]2OC(=O)c2ccccc2)c(=O)n1 |
| InChI | InChI=1S/C42H43N3O8Si/c1-5-35(46)43-34-26-27-45(41(49)44-34)38-37(53-40(48)30-20-12-7-13-21-30)36(52-39(47)29-18-10-6-11-19-29)33(51-38)28-50-54(42(2,3)4,31-22-14-8-15-23-31)32-24-16-9-17-25-32/h6-27,33,36-38H,5,28H2,1-4H3,(H,43,44,46,49)/t33-,36-,37+,38-/m1/s1 |
| InChIKey | GUYQGVBRZPMSCW-PVJCVKCRSA-N |
| XLogP | 5.52 |
| TPSA | 135.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 745.91 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|