C27H32FN3O4Si — CID 18345846
4-amino-1-[(2R,3R,5S)-5-[1-[tert-butyl(diphenyl)silyl]oxy-2-oxopropyl]-3-fluorooxolan-2-yl]pyrimidin-2-one (PubChem CID 18345846) has the molecular formula C27H32FN3O4Si and a molecular weight of 509.65 g/mol. Its IUPAC name is 4-amino-1-[(2R,3R,5S)-5-[1-[tert-butyl(diphenyl)silyl]oxy-2-oxopropyl]-3-fluorooxolan-2-yl]pyrimidin-2-one.
| Compound Name | 4-amino-1-[(2R,3R,5S)-5-[1-[tert-butyl(diphenyl)silyl]oxy-2-oxopropyl]-3-fluorooxolan-2-yl]pyrimidin-2-one |
|---|---|
| PubChem CID | 18345846 |
| Molecular Formula | C27H32FN3O4Si |
| Molecular Weight | 509.65 g/mol |
| Exact Mass | 509.21 |
| IUPAC Name | 4-amino-1-[(2R,3R,5S)-5-[1-[tert-butyl(diphenyl)silyl]oxy-2-oxopropyl]-3-fluorooxolan-2-yl]pyrimidin-2-one |
| SMILES | CC(=O)C(O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@@H]1C[C@@H](F)[C@H](n2ccc(N)nc2=O)O1 |
| InChI | InChI=1S/C27H32FN3O4Si/c1-18(32)24(22-17-21(28)25(34-22)31-16-15-23(29)30-26(31)33)35-36(27(2,3)4,19-11-7-5-8-12-19)20-13-9-6-10-14-20/h5-16,21-22,24-25H,17H2,1-4H3,(H2,29,30,33)/t21-,22+,24?,25-/m1/s1 |
| InChIKey | WBNDBDNXDSJICZ-JMZHNTCJSA-N |
| XLogP | 2.99 |
| TPSA | 96.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.65 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|