C33H46FN3O4Si2 — CID 175677925
4-amino-1-[(2R,3R,4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-ethenyl-3-fluorooxolan-2-yl]pyrimidin-2-one (PubChem CID 175677925) has the molecular formula C33H46FN3O4Si2 and a molecular weight of 623.92 g/mol. Its IUPAC name is 4-amino-1-[(2R,3R,4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-ethenyl-3-fluorooxolan-2-yl]pyrimidin-2-one.
| Compound Name | 4-amino-1-[(2R,3R,4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-ethenyl-3-fluorooxolan-2-yl]pyrimidin-2-one |
|---|---|
| PubChem CID | 175677925 |
| Molecular Formula | C33H46FN3O4Si2 |
| Molecular Weight | 623.92 g/mol |
| Exact Mass | 623.30 |
| IUPAC Name | 4-amino-1-[(2R,3R,4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-ethenyl-3-fluorooxolan-2-yl]pyrimidin-2-one |
| SMILES | C=C[C@]1(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)O[C@@H](n2ccc(N)nc2=O)[C@H](F)[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C33H46FN3O4Si2/c1-10-33(23-39-43(32(5,6)7,24-17-13-11-14-18-24)25-19-15-12-16-20-25)28(41-42(8,9)31(2,3)4)27(34)29(40-33)37-22-21-26(35)36-30(37)38/h10-22,27-29H,1,23H2,2-9H3,(H2,35,36,38)/t27-,28+,29-,33-/m1/s1 |
| InChIKey | HCRKVKPTZJAWCZ-VGBJTSDXSA-N |
| XLogP | 5.58 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.92 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|