C24H44N2O6Si2 — CID 67457364
1-[(2R,3R,4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-ethenyl-3-methoxyoxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 67457364) has the molecular formula C24H44N2O6Si2 and a molecular weight of 512.80 g/mol. Its IUPAC name is 1-[(2R,3R,4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-ethenyl-3-methoxyoxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3R,4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-ethenyl-3-methoxyoxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 67457364 |
| Molecular Formula | C24H44N2O6Si2 |
| Molecular Weight | 512.80 g/mol |
| Exact Mass | 512.27 |
| IUPAC Name | 1-[(2R,3R,4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-ethenyl-3-methoxyoxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | C=C[C@]1(CO[Si](C)(C)C(C)(C)C)O[C@@H](n2ccc(=O)[nH]c2=O)[C@H](OC)[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H44N2O6Si2/c1-13-24(16-30-33(9,10)22(2,3)4)19(32-34(11,12)23(5,6)7)18(29-8)20(31-24)26-15-14-17(27)25-21(26)28/h13-15,18-20H,1,16H2,2-12H3,(H,25,27,28)/t18-,19+,20-,24-/m1/s1 |
| InChIKey | KPUSUYRGMDLVEA-ZBNTXBBCSA-N |
| XLogP | 4.42 |
| TPSA | 91.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.80 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|