C23H43ClN2O5Si2 — CID 140703890
1-[(2R,3R,4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-chloro-5-ethyloxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 140703890) has the molecular formula C23H43ClN2O5Si2 and a molecular weight of 519.23 g/mol. Its IUPAC name is 1-[(2R,3R,4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-chloro-5-ethyloxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3R,4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-chloro-5-ethyloxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 140703890 |
| Molecular Formula | C23H43ClN2O5Si2 |
| Molecular Weight | 519.23 g/mol |
| Exact Mass | 518.24 |
| IUPAC Name | 1-[(2R,3R,4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-chloro-5-ethyloxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | CC[C@]1(CO[Si](C)(C)C(C)(C)C)O[C@@H](n2ccc(=O)[nH]c2=O)[C@H](Cl)[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H43ClN2O5Si2/c1-12-23(15-29-32(8,9)21(2,3)4)18(31-33(10,11)22(5,6)7)17(24)19(30-23)26-14-13-16(27)25-20(26)28/h13-14,17-19H,12,15H2,1-11H3,(H,25,27,28)/t17-,18+,19-,23-/m1/s1 |
| InChIKey | XNBWMDSSHRQFNJ-ISJRUSPKSA-N |
| XLogP | 5.23 |
| TPSA | 82.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.23 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|