C19H28F6N2O10S2Si — CID 169068205
[(3S,4S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-(2,4-dioxopyrimidin-1-yl)-4-methyl-2-(trifluoromethylsulfonyloxymethyl)oxolan-2-yl]methyl trifluoromethanesulfonate (PubChem CID 169068205) has the molecular formula C19H28F6N2O10S2Si and a molecular weight of 650.64 g/mol. Its IUPAC name is [(3S,4S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-(2,4-dioxopyrimidin-1-yl)-4-methyl-2-(trifluoromethylsulfonyloxymethyl)oxolan-2-yl]methyl trifluoromethanesulfonate.
| Compound Name | [(3S,4S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-(2,4-dioxopyrimidin-1-yl)-4-methyl-2-(trifluoromethylsulfonyloxymethyl)oxolan-2-yl]methyl trifluoromethanesulfonate |
|---|---|
| PubChem CID | 169068205 |
| Molecular Formula | C19H28F6N2O10S2Si |
| Molecular Weight | 650.64 g/mol |
| Exact Mass | 650.09 |
| IUPAC Name | [(3S,4S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-(2,4-dioxopyrimidin-1-yl)-4-methyl-2-(trifluoromethylsulfonyloxymethyl)oxolan-2-yl]methyl trifluoromethanesulfonate |
| SMILES | C[C@@H]1[C@H](n2ccc(=O)[nH]c2=O)OC(COS(=O)(=O)C(F)(F)F)(COS(=O)(=O)C(F)(F)F)[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H28F6N2O10S2Si/c1-11-13(37-40(5,6)16(2,3)4)17(9-34-38(30,31)18(20,21)22,10-35-39(32,33)19(23,24)25)36-14(11)27-8-7-12(28)26-15(27)29/h7-8,11,13-14H,9-10H2,1-6H3,(H,26,28,29)/t11-,13-,14+/m0/s1 |
| InChIKey | YEZFEVYMLAKCMB-FPMFFAJLSA-N |
| XLogP | 2.56 |
| TPSA | 160.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.64 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|