C16H27FN2O6Si — CID 169068521
1-[(2R,3S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-3-fluoro-5,5-bis(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 169068521) has the molecular formula C16H27FN2O6Si and a molecular weight of 390.48 g/mol. Its IUPAC name is 1-[(2R,3S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-3-fluoro-5,5-bis(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-3-fluoro-5,5-bis(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 169068521 |
| Molecular Formula | C16H27FN2O6Si |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | 1-[(2R,3S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-3-fluoro-5,5-bis(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1[C@H](F)[C@H](n2ccc(=O)[nH]c2=O)OC1(CO)CO |
| InChI | InChI=1S/C16H27FN2O6Si/c1-15(2,3)26(4,5)25-12-11(17)13(24-16(12,8-20)9-21)19-7-6-10(22)18-14(19)23/h6-7,11-13,20-21H,8-9H2,1-5H3,(H,18,22,23)/t11-,12-,13+/m0/s1 |
| InChIKey | FQCJMRIFHYTBRI-RWMBFGLXSA-N |
| XLogP | 0.52 |
| TPSA | 113.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|