C37H45FN2O8Si — CID 146157216
1-[(5S)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[tert-butyl(dimethyl)silyl]oxy-3-fluoro-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 146157216) has the molecular formula C37H45FN2O8Si and a molecular weight of 692.86 g/mol. Its IUPAC name is 1-[(5S)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[tert-butyl(dimethyl)silyl]oxy-3-fluoro-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(5S)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[tert-butyl(dimethyl)silyl]oxy-3-fluoro-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 146157216 |
| Molecular Formula | C37H45FN2O8Si |
| Molecular Weight | 692.86 g/mol |
| Exact Mass | 692.29 |
| IUPAC Name | 1-[(5S)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[tert-butyl(dimethyl)silyl]oxy-3-fluoro-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | COc1ccc(C(OC[C@]2(CO)OC(n3ccc(=O)[nH]c3=O)C(F)C2O[Si](C)(C)C(C)(C)C)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C37H45FN2O8Si/c1-35(2,3)49(6,7)48-32-31(38)33(40-22-21-30(42)39-34(40)43)47-36(32,23-41)24-46-37(25-11-9-8-10-12-25,26-13-17-28(44-4)18-14-26)27-15-19-29(45-5)20-16-27/h8-22,31-33,41H,23-24H2,1-7H3,(H,39,42,43)/t31?,32?,33?,36-/m0/s1 |
| InChIKey | KTPMIIZNPNQKBR-OOPATUSESA-N |
| XLogP | 5.55 |
| TPSA | 121.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.86 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|