C38H46N2O9Si — CID 10794847
2-[(2S,3R,4R,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[tert-butyl(dimethyl)silyl]oxy-5-(2,4-dioxopyrimidin-1-yl)oxolan-3-yl]acetic acid (PubChem CID 10794847) has the molecular formula C38H46N2O9Si and a molecular weight of 702.88 g/mol. Its IUPAC name is 2-[(2S,3R,4R,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[tert-butyl(dimethyl)silyl]oxy-5-(2,4-dioxopyrimidin-1-yl)oxolan-3-yl]acetic acid.
| Compound Name | 2-[(2S,3R,4R,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[tert-butyl(dimethyl)silyl]oxy-5-(2,4-dioxopyrimidin-1-yl)oxolan-3-yl]acetic acid |
|---|---|
| PubChem CID | 10794847 |
| Molecular Formula | C38H46N2O9Si |
| Molecular Weight | 702.88 g/mol |
| Exact Mass | 702.30 |
| IUPAC Name | 2-[(2S,3R,4R,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[tert-butyl(dimethyl)silyl]oxy-5-(2,4-dioxopyrimidin-1-yl)oxolan-3-yl]acetic acid |
| SMILES | COc1ccc(C(OC[C@H]2O[C@@H](n3ccc(=O)[nH]c3=O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]2CC(=O)O)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C38H46N2O9Si/c1-37(2,3)50(6,7)49-34-30(23-33(42)43)31(48-35(34)40-22-21-32(41)39-36(40)44)24-47-38(25-11-9-8-10-12-25,26-13-17-28(45-4)18-14-26)27-15-19-29(46-5)20-16-27/h8-22,30-31,34-35H,23-24H2,1-7H3,(H,42,43)(H,39,41,44)/t30-,31-,34-,35-/m1/s1 |
| InChIKey | KSDHOUPMWVGKLT-NJANNMLCSA-N |
| XLogP | 5.94 |
| TPSA | 138.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.88 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|