C42H51N4O10PSi — CID 10771781
[(2R,3R,4R,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[tert-butyl(dimethyl)silyl]oxy-5-(2,4-dioxopyrimidin-1-yl)oxolan-3-yl] bis(2-cyanoethyl) phosphite (PubChem CID 10771781) has the molecular formula C42H51N4O10PSi and a molecular weight of 830.95 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[tert-butyl(dimethyl)silyl]oxy-5-(2,4-dioxopyrimidin-1-yl)oxolan-3-yl] bis(2-cyanoethyl) phosphite.
| Compound Name | [(2R,3R,4R,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[tert-butyl(dimethyl)silyl]oxy-5-(2,4-dioxopyrimidin-1-yl)oxolan-3-yl] bis(2-cyanoethyl) phosphite |
|---|---|
| PubChem CID | 10771781 |
| Molecular Formula | C42H51N4O10PSi |
| Molecular Weight | 830.95 g/mol |
| Exact Mass | 830.31 |
| IUPAC Name | [(2R,3R,4R,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[tert-butyl(dimethyl)silyl]oxy-5-(2,4-dioxopyrimidin-1-yl)oxolan-3-yl] bis(2-cyanoethyl) phosphite |
| SMILES | COc1ccc(C(OC[C@H]2O[C@@H](n3ccc(=O)[nH]c3=O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]2OP(OCCC#N)OCCC#N)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C42H51N4O10PSi/c1-41(2,3)58(6,7)56-38-37(55-57(52-27-11-24-43)53-28-12-25-44)35(54-39(38)46-26-23-36(47)45-40(46)48)29-51-42(30-13-9-8-10-14-30,31-15-19-33(49-4)20-16-31)32-17-21-34(50-5)22-18-32/h8-10,13-23,26,35,37-39H,11-12,27-29H2,1-7H3,(H,45,47,48)/t35-,37-,38-,39-/m1/s1 |
| InChIKey | HGBXKPLHEZRRJN-JMGLZSBTSA-N |
| XLogP | 7.32 |
| TPSA | 176.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 830.95 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|