C17H28N2O7Si — CID 10525035
2-[(2S,3R,4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-(2,4-dioxopyrimidin-1-yl)-2-(hydroxymethyl)oxolan-3-yl]acetic acid (PubChem CID 10525035) has the molecular formula C17H28N2O7Si and a molecular weight of 400.50 g/mol. Its IUPAC name is 2-[(2S,3R,4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-(2,4-dioxopyrimidin-1-yl)-2-(hydroxymethyl)oxolan-3-yl]acetic acid.
| Compound Name | 2-[(2S,3R,4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-(2,4-dioxopyrimidin-1-yl)-2-(hydroxymethyl)oxolan-3-yl]acetic acid |
|---|---|
| PubChem CID | 10525035 |
| Molecular Formula | C17H28N2O7Si |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | 2-[(2S,3R,4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-(2,4-dioxopyrimidin-1-yl)-2-(hydroxymethyl)oxolan-3-yl]acetic acid |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1[C@H](CC(=O)O)[C@@H](CO)O[C@H]1n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C17H28N2O7Si/c1-17(2,3)27(4,5)26-14-10(8-13(22)23)11(9-20)25-15(14)19-7-6-12(21)18-16(19)24/h6-7,10-11,14-15,20H,8-9H2,1-5H3,(H,22,23)(H,18,21,24)/t10-,11-,14-,15-/m1/s1 |
| InChIKey | UEMAXDVFUHYVPP-YIKOMLBNSA-N |
| XLogP | 0.91 |
| TPSA | 130.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|