C25H35N3O8Si — CID 11850095
2-[(2R,3R,4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-(2,4-dioxopyrimidin-1-yl)-3-(phenylmethoxycarbonylaminomethyl)oxolan-2-yl]acetic acid (PubChem CID 11850095) has the molecular formula C25H35N3O8Si and a molecular weight of 533.65 g/mol. Its IUPAC name is 2-[(2R,3R,4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-(2,4-dioxopyrimidin-1-yl)-3-(phenylmethoxycarbonylaminomethyl)oxolan-2-yl]acetic acid.
| Compound Name | 2-[(2R,3R,4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-(2,4-dioxopyrimidin-1-yl)-3-(phenylmethoxycarbonylaminomethyl)oxolan-2-yl]acetic acid |
|---|---|
| PubChem CID | 11850095 |
| Molecular Formula | C25H35N3O8Si |
| Molecular Weight | 533.65 g/mol |
| Exact Mass | 533.22 |
| IUPAC Name | 2-[(2R,3R,4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-(2,4-dioxopyrimidin-1-yl)-3-(phenylmethoxycarbonylaminomethyl)oxolan-2-yl]acetic acid |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1[C@H](CNC(=O)OCc2ccccc2)[C@@H](CC(=O)O)O[C@H]1n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C25H35N3O8Si/c1-25(2,3)37(4,5)36-21-17(14-26-24(33)34-15-16-9-7-6-8-10-16)18(13-20(30)31)35-22(21)28-12-11-19(29)27-23(28)32/h6-12,17-18,21-22H,13-15H2,1-5H3,(H,26,33)(H,30,31)(H,27,29,32)/t17-,18-,21-,22-/m1/s1 |
| InChIKey | KIUDJXSSIORTMD-MCEIDBOGSA-N |
| XLogP | 2.84 |
| TPSA | 148.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.65 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|