C35H55N3O9Si2 — CID 56930831
tert-butyl (Z)-3-[(2R,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-(2,4-dioxopyrimidin-1-yl)oxolan-2-yl]-2-(phenylmethoxycarbonylamino)prop-2-enoate (PubChem CID 56930831) has the molecular formula C35H55N3O9Si2 and a molecular weight of 718.01 g/mol. Its IUPAC name is tert-butyl (Z)-3-[(2R,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-(2,4-dioxopyrimidin-1-yl)oxolan-2-yl]-2-(phenylmethoxycarbonylamino)prop-2-enoate.
| Compound Name | tert-butyl (Z)-3-[(2R,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-(2,4-dioxopyrimidin-1-yl)oxolan-2-yl]-2-(phenylmethoxycarbonylamino)prop-2-enoate |
|---|---|
| PubChem CID | 56930831 |
| Molecular Formula | C35H55N3O9Si2 |
| Molecular Weight | 718.01 g/mol |
| Exact Mass | 717.35 |
| IUPAC Name | tert-butyl (Z)-3-[(2R,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-(2,4-dioxopyrimidin-1-yl)oxolan-2-yl]-2-(phenylmethoxycarbonylamino)prop-2-enoate |
| SMILES | CC(C)(C)OC(=O)/C(=C/[C@H]1O[C@@H](n2ccc(=O)[nH]c2=O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C35H55N3O9Si2/c1-33(2,3)45-30(40)24(36-32(42)43-22-23-17-15-14-16-18-23)21-25-27(46-48(10,11)34(4,5)6)28(47-49(12,13)35(7,8)9)29(44-25)38-20-19-26(39)37-31(38)41/h14-21,25,27-29H,22H2,1-13H3,(H,36,42)(H,37,39,41)/b24-21-/t25-,27-,28-,29-/m1/s1 |
| InChIKey | ZRIHXFFBGISQCF-BUPSQIGHSA-N |
| XLogP | 6.37 |
| TPSA | 147.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.01 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|