C21H41N3O5Si2 — CID 10719208
1-[(2R,3R,4R,5R)-5-(aminomethyl)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]oxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 10719208) has the molecular formula C21H41N3O5Si2 and a molecular weight of 471.75 g/mol. Its IUPAC name is 1-[(2R,3R,4R,5R)-5-(aminomethyl)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]oxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3R,4R,5R)-5-(aminomethyl)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]oxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 10719208 |
| Molecular Formula | C21H41N3O5Si2 |
| Molecular Weight | 471.75 g/mol |
| Exact Mass | 471.26 |
| IUPAC Name | 1-[(2R,3R,4R,5R)-5-(aminomethyl)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]oxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](CN)O[C@H]1n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C21H41N3O5Si2/c1-20(2,3)30(7,8)28-16-14(13-22)27-18(24-12-11-15(25)23-19(24)26)17(16)29-31(9,10)21(4,5)6/h11-12,14,16-18H,13,22H2,1-10H3,(H,23,25,26)/t14-,16-,17-,18-/m1/s1 |
| InChIKey | RFCNJNDUVJWQCA-VDHUWJSZSA-N |
| XLogP | 3.17 |
| TPSA | 108.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.75 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|