C21H37N3O6Si — CID 166470324
1-[(2R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-5-(piperidin-1-yloxymethyl)oxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 166470324) has the molecular formula C21H37N3O6Si and a molecular weight of 455.63 g/mol. Its IUPAC name is 1-[(2R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-5-(piperidin-1-yloxymethyl)oxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-5-(piperidin-1-yloxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 166470324 |
| Molecular Formula | C21H37N3O6Si |
| Molecular Weight | 455.63 g/mol |
| Exact Mass | 455.25 |
| IUPAC Name | 1-[(2R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-5-(piperidin-1-yloxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | COC1C(O[Si](C)(C)C(C)(C)C)[C@@H](CON2CCCCC2)O[C@H]1n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C21H37N3O6Si/c1-21(2,3)31(5,6)30-17-15(14-28-23-11-8-7-9-12-23)29-19(18(17)27-4)24-13-10-16(25)22-20(24)26/h10,13,15,17-19H,7-9,11-12,14H2,1-6H3,(H,22,25,26)/t15-,17?,18?,19-/m1/s1 |
| InChIKey | BEZUAWMSPROHRV-JYPHPWERSA-N |
| XLogP | 2.26 |
| TPSA | 95.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.63 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|