C12H18N2O5 — CID 173465347
1-[(2S,4S,5R)-5-ethyl-3,4-dimethoxyoxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 173465347) has the molecular formula C12H18N2O5 and a molecular weight of 270.29 g/mol. Its IUPAC name is 1-[(2S,4S,5R)-5-ethyl-3,4-dimethoxyoxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2S,4S,5R)-5-ethyl-3,4-dimethoxyoxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 173465347 |
| Molecular Formula | C12H18N2O5 |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | 1-[(2S,4S,5R)-5-ethyl-3,4-dimethoxyoxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | CC[C@H]1O[C@H](n2ccc(=O)[nH]c2=O)C(OC)[C@H]1OC |
| InChI | InChI=1S/C12H18N2O5/c1-4-7-9(17-2)10(18-3)11(19-7)14-6-5-8(15)13-12(14)16/h5-7,9-11H,4H2,1-3H3,(H,13,15,16)/t7-,9+,10?,11+/m1/s1 |
| InChIKey | MGIAZXHYMFRWAR-QWDIWVAESA-N |
| XLogP | -0.13 |
| TPSA | 82.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |