C14H18N2O5 — CID 174082533
1-[(2R,3S,5R)-5-ethyl-3-methoxy-4-prop-2-ynoxyoxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 174082533) has the molecular formula C14H18N2O5 and a molecular weight of 294.31 g/mol. Its IUPAC name is 1-[(2R,3S,5R)-5-ethyl-3-methoxy-4-prop-2-ynoxyoxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3S,5R)-5-ethyl-3-methoxy-4-prop-2-ynoxyoxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 174082533 |
| Molecular Formula | C14H18N2O5 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | 1-[(2R,3S,5R)-5-ethyl-3-methoxy-4-prop-2-ynoxyoxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | C#CCOC1[C@@H](CC)O[C@@H](n2ccc(=O)[nH]c2=O)[C@H]1OC |
| InChI | InChI=1S/C14H18N2O5/c1-4-8-20-11-9(5-2)21-13(12(11)19-3)16-7-6-10(17)15-14(16)18/h1,6-7,9,11-13H,5,8H2,2-3H3,(H,15,17,18)/t9-,11?,12+,13-/m1/s1 |
| InChIKey | UTMZHLPHJWGSKZ-KLBFZIACSA-N |
| XLogP | -0.12 |
| TPSA | 82.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|