C12H19N3O7S — CID 174076838
1-[(2S,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dimethoxyoxolan-2-yl]-N-methylmethanesulfonamide (PubChem CID 174076838) has the molecular formula C12H19N3O7S and a molecular weight of 349.37 g/mol. Its IUPAC name is 1-[(2S,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dimethoxyoxolan-2-yl]-N-methylmethanesulfonamide.
| Compound Name | 1-[(2S,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dimethoxyoxolan-2-yl]-N-methylmethanesulfonamide |
|---|---|
| PubChem CID | 174076838 |
| Molecular Formula | C12H19N3O7S |
| Molecular Weight | 349.37 g/mol |
| Exact Mass | 349.09 |
| IUPAC Name | 1-[(2S,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dimethoxyoxolan-2-yl]-N-methylmethanesulfonamide |
| SMILES | CNS(=O)(=O)C[C@H]1O[C@@H](n2ccc(=O)[nH]c2=O)[C@H](OC)[C@@H]1OC |
| InChI | InChI=1S/C12H19N3O7S/c1-13-23(18,19)6-7-9(20-2)10(21-3)11(22-7)15-5-4-8(16)14-12(15)17/h4-5,7,9-11,13H,6H2,1-3H3,(H,14,16,17)/t7-,9-,10-,11-/m1/s1 |
| InChIKey | DHLZQQFIQTZVIC-QCNRFFRDSA-N |
| XLogP | -1.99 |
| TPSA | 128.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.37 |
| LogP ≤ 5 | -1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |