C11H16N2O5 — CID 164958906
1-[(2R,3R,4R,5R)-5-(1,1-dideuterioethyl)-4-hydroxy-3-methoxyoxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 164958906) has the molecular formula C11H16N2O5 and a molecular weight of 258.27 g/mol. Its IUPAC name is 1-[(2R,3R,4R,5R)-5-(1,1-dideuterioethyl)-4-hydroxy-3-methoxyoxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3R,4R,5R)-5-(1,1-dideuterioethyl)-4-hydroxy-3-methoxyoxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 164958906 |
| Molecular Formula | C11H16N2O5 |
| Molecular Weight | 258.27 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | 1-[(2R,3R,4R,5R)-5-(1,1-dideuterioethyl)-4-hydroxy-3-methoxyoxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | [2H]C([2H])(C)[C@H]1O[C@@H](n2ccc(=O)[nH]c2=O)[C@H](OC)[C@@H]1O |
| InChI | InChI=1S/C11H16N2O5/c1-3-6-8(15)9(17-2)10(18-6)13-5-4-7(14)12-11(13)16/h4-6,8-10,15H,3H2,1-2H3,(H,12,14,16)/t6-,8-,9-,10-/m1/s1/i3D2 |
| InChIKey | YGPDRVQTQSDCKT-FGDLPDOQSA-N |
| XLogP | -0.78 |
| TPSA | 93.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.27 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |