C10H13FN2O4 — CID 164998419
1-[(2R,3R,4R,5R)-5-(1,1-dideuterioethyl)-3-fluoro-4-hydroxyoxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 164998419) has the molecular formula C10H13FN2O4 and a molecular weight of 246.23 g/mol. Its IUPAC name is 1-[(2R,3R,4R,5R)-5-(1,1-dideuterioethyl)-3-fluoro-4-hydroxyoxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3R,4R,5R)-5-(1,1-dideuterioethyl)-3-fluoro-4-hydroxyoxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 164998419 |
| Molecular Formula | C10H13FN2O4 |
| Molecular Weight | 246.23 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | 1-[(2R,3R,4R,5R)-5-(1,1-dideuterioethyl)-3-fluoro-4-hydroxyoxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | [2H]C([2H])(C)[C@H]1O[C@@H](n2ccc(=O)[nH]c2=O)[C@H](F)[C@@H]1O |
| InChI | InChI=1S/C10H13FN2O4/c1-2-5-8(15)7(11)9(17-5)13-4-3-6(14)12-10(13)16/h3-5,7-9,15H,2H2,1H3,(H,12,14,16)/t5-,7-,8-,9-/m1/s1/i2D2 |
| InChIKey | PAUYCMCJPIPWMK-DEOUBFAVSA-N |
| XLogP | -0.46 |
| TPSA | 84.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.23 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |