C9H9FN2O5 — CID 123909297
5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxyoxolane-2-carbaldehyde (PubChem CID 123909297) has the molecular formula C9H9FN2O5 and a molecular weight of 244.18 g/mol. Its IUPAC name is 5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxyoxolane-2-carbaldehyde.
| Compound Name | 5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxyoxolane-2-carbaldehyde |
|---|---|
| PubChem CID | 123909297 |
| Molecular Formula | C9H9FN2O5 |
| Molecular Weight | 244.18 g/mol |
| Exact Mass | 244.05 |
| IUPAC Name | 5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxyoxolane-2-carbaldehyde |
| SMILES | O=CC1OC(n2ccc(=O)[nH]c2=O)C(F)C1O |
| InChI | InChI=1S/C9H9FN2O5/c10-6-7(15)4(3-13)17-8(6)12-2-1-5(14)11-9(12)16/h1-4,6-8,15H,(H,11,14,16) |
| InChIKey | IGTQNIOWOSUWJG-UHFFFAOYSA-N |
| XLogP | -1.67 |
| TPSA | 101.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.18 |
| LogP ≤ 5 | -1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|