C8H9FN2O4 — CID 70871082
1-[(2R,3R,4R)-3-fluoro-4-hydroxyoxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 70871082) has the molecular formula C8H9FN2O4 and a molecular weight of 216.17 g/mol. Its IUPAC name is 1-[(2R,3R,4R)-3-fluoro-4-hydroxyoxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3R,4R)-3-fluoro-4-hydroxyoxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 70871082 |
| Molecular Formula | C8H9FN2O4 |
| Molecular Weight | 216.17 g/mol |
| Exact Mass | 216.05 |
| IUPAC Name | 1-[(2R,3R,4R)-3-fluoro-4-hydroxyoxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | O=c1ccn([C@@H]2OC[C@@H](O)[C@H]2F)c(=O)[nH]1 |
| InChI | InChI=1S/C8H9FN2O4/c9-6-4(12)3-15-7(6)11-2-1-5(13)10-8(11)14/h1-2,4,6-7,12H,3H2,(H,10,13,14)/t4-,6-,7-/m1/s1 |
| InChIKey | XJHMWVTYQRRAMU-QPPQHZFASA-N |
| XLogP | -1.24 |
| TPSA | 84.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.17 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |