C9H9FN2O5 — CID 163773061
1-[(3R,4R,5E)-3-fluoro-4-hydroxy-5-(hydroxymethylidene)oxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 163773061) has the molecular formula C9H9FN2O5 and a molecular weight of 244.18 g/mol. Its IUPAC name is 1-[(3R,4R,5E)-3-fluoro-4-hydroxy-5-(hydroxymethylidene)oxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(3R,4R,5E)-3-fluoro-4-hydroxy-5-(hydroxymethylidene)oxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 163773061 |
| Molecular Formula | C9H9FN2O5 |
| Molecular Weight | 244.18 g/mol |
| Exact Mass | 244.05 |
| IUPAC Name | 1-[(3R,4R,5E)-3-fluoro-4-hydroxy-5-(hydroxymethylidene)oxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | O=c1ccn(C2O/C(=C/O)[C@@H](O)[C@H]2F)c(=O)[nH]1 |
| InChI | InChI=1S/C9H9FN2O5/c10-6-7(15)4(3-13)17-8(6)12-2-1-5(14)11-9(12)16/h1-3,6-8,13,15H,(H,11,14,16)/b4-3+/t6-,7-,8?/m1/s1 |
| InChIKey | MIBQOXIEQGBQHS-NRHFUFHYSA-N |
| XLogP | -0.84 |
| TPSA | 104.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.18 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|