C10H12FN2O7P — CID 68594152
2-[5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxyoxolan-2-yl]ethenylphosphonic acid (PubChem CID 68594152) has the molecular formula C10H12FN2O7P and a molecular weight of 322.19 g/mol. Its IUPAC name is 2-[5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxyoxolan-2-yl]ethenylphosphonic acid.
| Compound Name | 2-[5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxyoxolan-2-yl]ethenylphosphonic acid |
|---|---|
| PubChem CID | 68594152 |
| Molecular Formula | C10H12FN2O7P |
| Molecular Weight | 322.19 g/mol |
| Exact Mass | 322.04 |
| IUPAC Name | 2-[5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxyoxolan-2-yl]ethenylphosphonic acid |
| SMILES | O=c1ccn(C2OC(C=CP(=O)(O)O)C(O)C2F)c(=O)[nH]1 |
| InChI | InChI=1S/C10H12FN2O7P/c11-7-8(15)5(2-4-21(17,18)19)20-9(7)13-3-1-6(14)12-10(13)16/h1-5,7-9,15H,(H,12,14,16)(H2,17,18,19) |
| InChIKey | MFJSMSUFJROBMZ-UHFFFAOYSA-N |
| XLogP | -1.18 |
| TPSA | 141.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.19 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|