C9H15N2O9P — CID 68506781
1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-methyloxolan-2-yl]pyrimidine-2,4-dione;phosphoric acid (PubChem CID 68506781) has the molecular formula C9H15N2O9P and a molecular weight of 326.20 g/mol. Its IUPAC name is 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-methyloxolan-2-yl]pyrimidine-2,4-dione;phosphoric acid.
| Compound Name | 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-methyloxolan-2-yl]pyrimidine-2,4-dione;phosphoric acid |
|---|---|
| PubChem CID | 68506781 |
| Molecular Formula | C9H15N2O9P |
| Molecular Weight | 326.20 g/mol |
| Exact Mass | 326.05 |
| IUPAC Name | 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-methyloxolan-2-yl]pyrimidine-2,4-dione;phosphoric acid |
| SMILES | C[C@H]1O[C@@H](n2ccc(=O)[nH]c2=O)[C@H](O)[C@@H]1O.O=P(O)(O)O |
| InChI | InChI=1S/C9H12N2O5.H3O4P/c1-4-6(13)7(14)8(16-4)11-3-2-5(12)10-9(11)15;1-5(2,3)4/h2-4,6-8,13-14H,1H3,(H,10,12,15);(H3,1,2,3,4)/t4-,6-,7-,8-;/m1./s1 |
| InChIKey | SWZUUFUZLMPDOZ-IAIGYFSYSA-N |
| XLogP | -2.75 |
| TPSA | 182.31 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.20 |
| LogP ≤ 5 | -2.75 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|