C9H18N2O14P2 — CID 23616153
1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione;phosphoric acid (PubChem CID 23616153) has the molecular formula C9H18N2O14P2 and a molecular weight of 440.19 g/mol. Its IUPAC name is 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione;phosphoric acid.
| Compound Name | 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione;phosphoric acid |
|---|---|
| PubChem CID | 23616153 |
| Molecular Formula | C9H18N2O14P2 |
| Molecular Weight | 440.19 g/mol |
| Exact Mass | 440.02 |
| IUPAC Name | 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione;phosphoric acid |
| SMILES | O=P(O)(O)O.O=P(O)(O)O.O=c1ccn([C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)c(=O)[nH]1 |
| InChI | InChI=1S/C9H12N2O6.2H3O4P/c12-3-4-6(14)7(15)8(17-4)11-2-1-5(13)10-9(11)16;2*1-5(2,3)4/h1-2,4,6-8,12,14-15H,3H2,(H,10,13,16);2*(H3,1,2,3,4)/t4-,6-,7-,8-;;/m1../s1 |
| InChIKey | PMPFLUWUGZHTOK-WFIJOQBCSA-N |
| XLogP | -4.71 |
| TPSA | 280.30 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.19 |
| LogP ≤ 5 | -4.71 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|