C9H12N2NaO6 — CID 70523066
CID 70523066 (PubChem CID 70523066) has the molecular formula C9H12N2NaO6 and a molecular weight of 267.19 g/mol.
| Compound Name | CID 70523066 |
|---|---|
| PubChem CID | 70523066 |
| Molecular Formula | C9H12N2NaO6 |
| Molecular Weight | 267.19 g/mol |
| Exact Mass | 267.06 |
| IUPAC Name | — |
| SMILES | O=c1ccn([C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)c(=O)[nH]1.[Na] |
| InChI | InChI=1S/C9H12N2O6.Na/c12-3-4-6(14)7(15)8(17-4)11-2-1-5(13)10-9(11)16;/h1-2,4,6-8,12,14-15H,3H2,(H,10,13,16);/t4-,6-,7-,8-;/m1./s1 |
| InChIKey | OMLQHJRGFGCXDH-IAIGYFSYSA-N |
| XLogP | -3.23 |
| TPSA | 124.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.19 |
| LogP ≤ 5 | -3.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |