C14H22N2O10P2 — CID 118933232
[(E)-2-[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3-[hydroxy(propan-2-yl)phosphoryl]oxy-4-methoxyoxolan-2-yl]ethenyl]phosphonic acid (PubChem CID 118933232) has the molecular formula C14H22N2O10P2 and a molecular weight of 440.28 g/mol. Its IUPAC name is [(E)-2-[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3-[hydroxy(propan-2-yl)phosphoryl]oxy-4-methoxyoxolan-2-yl]ethenyl]phosphonic acid.
| Compound Name | [(E)-2-[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3-[hydroxy(propan-2-yl)phosphoryl]oxy-4-methoxyoxolan-2-yl]ethenyl]phosphonic acid |
|---|---|
| PubChem CID | 118933232 |
| Molecular Formula | C14H22N2O10P2 |
| Molecular Weight | 440.28 g/mol |
| Exact Mass | 440.07 |
| IUPAC Name | [(E)-2-[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3-[hydroxy(propan-2-yl)phosphoryl]oxy-4-methoxyoxolan-2-yl]ethenyl]phosphonic acid |
| SMILES | CO[C@@H]1[C@H](OP(=O)(O)C(C)C)[C@@H](/C=C/P(=O)(O)O)O[C@H]1n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C14H22N2O10P2/c1-8(2)28(22,23)26-11-9(5-7-27(19,20)21)25-13(12(11)24-3)16-6-4-10(17)15-14(16)18/h4-9,11-13H,1-3H3,(H,22,23)(H,15,17,18)(H2,19,20,21)/b7-5+/t9-,11-,12-,13-/m1/s1 |
| InChIKey | JHLFMRRDKWQPGA-SJNGWIOZSA-N |
| XLogP | 0.12 |
| TPSA | 177.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.28 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|