C14H23N2O9P — CID 126576968
1-[(2S,3S,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-methoxy-3-propan-2-yloxyoxolan-2-yl]ethyl dihydrogen phosphate (PubChem CID 126576968) has the molecular formula C14H23N2O9P and a molecular weight of 394.32 g/mol. Its IUPAC name is 1-[(2S,3S,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-methoxy-3-propan-2-yloxyoxolan-2-yl]ethyl dihydrogen phosphate.
| Compound Name | 1-[(2S,3S,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-methoxy-3-propan-2-yloxyoxolan-2-yl]ethyl dihydrogen phosphate |
|---|---|
| PubChem CID | 126576968 |
| Molecular Formula | C14H23N2O9P |
| Molecular Weight | 394.32 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | 1-[(2S,3S,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-methoxy-3-propan-2-yloxyoxolan-2-yl]ethyl dihydrogen phosphate |
| SMILES | COC1[C@@H](OC(C)C)[C@@H](C(C)OP(=O)(O)O)O[C@H]1n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C14H23N2O9P/c1-7(2)23-11-10(8(3)25-26(19,20)21)24-13(12(11)22-4)16-6-5-9(17)15-14(16)18/h5-8,10-13H,1-4H3,(H,15,17,18)(H2,19,20,21)/t8?,10-,11+,12?,13-/m1/s1 |
| InChIKey | MOTYQYKRIDFQRG-GJCHWOHRSA-N |
| XLogP | -0.26 |
| TPSA | 149.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.32 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|