C12H19N2O9P — CID 139337736
1-[5-(2,4-dioxopyrimidin-1-yl)-3,4-dimethoxyoxolan-2-yl]ethyl dihydrogen phosphate (PubChem CID 139337736) has the molecular formula C12H19N2O9P and a molecular weight of 366.26 g/mol. Its IUPAC name is 1-[5-(2,4-dioxopyrimidin-1-yl)-3,4-dimethoxyoxolan-2-yl]ethyl dihydrogen phosphate.
| Compound Name | 1-[5-(2,4-dioxopyrimidin-1-yl)-3,4-dimethoxyoxolan-2-yl]ethyl dihydrogen phosphate |
|---|---|
| PubChem CID | 139337736 |
| Molecular Formula | C12H19N2O9P |
| Molecular Weight | 366.26 g/mol |
| Exact Mass | 366.08 |
| IUPAC Name | 1-[5-(2,4-dioxopyrimidin-1-yl)-3,4-dimethoxyoxolan-2-yl]ethyl dihydrogen phosphate |
| SMILES | COC1C(C(C)OP(=O)(O)O)OC(n2ccc(=O)[nH]c2=O)C1OC |
| InChI | InChI=1S/C12H19N2O9P/c1-6(23-24(17,18)19)8-9(20-2)10(21-3)11(22-8)14-5-4-7(15)13-12(14)16/h4-6,8-11H,1-3H3,(H,13,15,16)(H2,17,18,19) |
| InChIKey | DLYBAZPFRNUNFR-UHFFFAOYSA-N |
| XLogP | -1.04 |
| TPSA | 149.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.26 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|