C13H22N2O11P2 — CID 140911461
[(2R,3R,4R,5R)-2-(2,4-dioxopyrimidin-1-yl)-4-methoxy-5-(phosphonooxymethyl)oxolan-3-yl]oxy-propan-2-ylphosphinic acid (PubChem CID 140911461) has the molecular formula C13H22N2O11P2 and a molecular weight of 444.27 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-2-(2,4-dioxopyrimidin-1-yl)-4-methoxy-5-(phosphonooxymethyl)oxolan-3-yl]oxy-propan-2-ylphosphinic acid.
| Compound Name | [(2R,3R,4R,5R)-2-(2,4-dioxopyrimidin-1-yl)-4-methoxy-5-(phosphonooxymethyl)oxolan-3-yl]oxy-propan-2-ylphosphinic acid |
|---|---|
| PubChem CID | 140911461 |
| Molecular Formula | C13H22N2O11P2 |
| Molecular Weight | 444.27 g/mol |
| Exact Mass | 444.07 |
| IUPAC Name | [(2R,3R,4R,5R)-2-(2,4-dioxopyrimidin-1-yl)-4-methoxy-5-(phosphonooxymethyl)oxolan-3-yl]oxy-propan-2-ylphosphinic acid |
| SMILES | CO[C@H]1[C@@H](OP(=O)(O)C(C)C)[C@H](n2ccc(=O)[nH]c2=O)O[C@@H]1COP(=O)(O)O |
| InChI | InChI=1S/C13H22N2O11P2/c1-7(2)27(18,19)26-11-10(23-3)8(6-24-28(20,21)22)25-12(11)15-5-4-9(16)14-13(15)17/h4-5,7-8,10-12H,6H2,1-3H3,(H,18,19)(H,14,16,17)(H2,20,21,22)/t8-,10-,11-,12-/m1/s1 |
| InChIKey | AJCJWIZXRWIRKF-HJQYOEGKSA-N |
| XLogP | -0.46 |
| TPSA | 186.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.27 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|