C12H19FN2O10P2 — CID 118933205
[(2R,3S,4R,5R)-2-(2,4-dioxopyrimidin-1-yl)-4-fluoro-5-(phosphonooxymethyl)oxolan-3-yl]oxy-propan-2-ylphosphinic acid (PubChem CID 118933205) has the molecular formula C12H19FN2O10P2 and a molecular weight of 432.23 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-2-(2,4-dioxopyrimidin-1-yl)-4-fluoro-5-(phosphonooxymethyl)oxolan-3-yl]oxy-propan-2-ylphosphinic acid.
| Compound Name | [(2R,3S,4R,5R)-2-(2,4-dioxopyrimidin-1-yl)-4-fluoro-5-(phosphonooxymethyl)oxolan-3-yl]oxy-propan-2-ylphosphinic acid |
|---|---|
| PubChem CID | 118933205 |
| Molecular Formula | C12H19FN2O10P2 |
| Molecular Weight | 432.23 g/mol |
| Exact Mass | 432.05 |
| IUPAC Name | [(2R,3S,4R,5R)-2-(2,4-dioxopyrimidin-1-yl)-4-fluoro-5-(phosphonooxymethyl)oxolan-3-yl]oxy-propan-2-ylphosphinic acid |
| SMILES | CC(C)P(=O)(O)O[C@@H]1[C@H](F)[C@@H](COP(=O)(O)O)O[C@H]1n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C12H19FN2O10P2/c1-6(2)26(18,19)25-10-9(13)7(5-23-27(20,21)22)24-11(10)15-4-3-8(16)14-12(15)17/h3-4,6-7,9-11H,5H2,1-2H3,(H,18,19)(H,14,16,17)(H2,20,21,22)/t7-,9-,10-,11-/m1/s1 |
| InChIKey | ZWXRGVBFVSTLFN-QCNRFFRDSA-N |
| XLogP | -0.14 |
| TPSA | 177.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.23 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|