C10H15N2O8PSe — CID 137347892
[(2S,3S,4S,5S)-5-(2,4-dioxopyrimidin-1-yl)-3-hydroxy-4-methylselanyloxolan-2-yl]methyl dihydrogen phosphate (PubChem CID 137347892) has the molecular formula C10H15N2O8PSe and a molecular weight of 401.17 g/mol. Its IUPAC name is [(2S,3S,4S,5S)-5-(2,4-dioxopyrimidin-1-yl)-3-hydroxy-4-methylselanyloxolan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [(2S,3S,4S,5S)-5-(2,4-dioxopyrimidin-1-yl)-3-hydroxy-4-methylselanyloxolan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 137347892 |
| Molecular Formula | C10H15N2O8PSe |
| Molecular Weight | 401.17 g/mol |
| Exact Mass | 401.97 |
| IUPAC Name | [(2S,3S,4S,5S)-5-(2,4-dioxopyrimidin-1-yl)-3-hydroxy-4-methylselanyloxolan-2-yl]methyl dihydrogen phosphate |
| SMILES | C[Se][C@H]1[C@@H](O)[C@H](COP(=O)(O)O)O[C@@H]1n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C10H15N2O8PSe/c1-22-8-7(14)5(4-19-21(16,17)18)20-9(8)12-3-2-6(13)11-10(12)15/h2-3,5,7-9,14H,4H2,1H3,(H,11,13,15)(H2,16,17,18)/t5-,7-,8-,9-/m0/s1 |
| InChIKey | PADIGPKUSVFCBC-ZITKLIBNSA-N |
| XLogP | -1.55 |
| TPSA | 151.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.17 |
| LogP ≤ 5 | -1.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|