C11H17N2O8P — CID 153213214
[(2R,5R)-5-(2,4-dioxopyrimidin-1-yl)-2-ethyl-4-methoxyoxolan-3-yl] dihydrogen phosphate (PubChem CID 153213214) has the molecular formula C11H17N2O8P and a molecular weight of 336.24 g/mol. Its IUPAC name is [(2R,5R)-5-(2,4-dioxopyrimidin-1-yl)-2-ethyl-4-methoxyoxolan-3-yl] dihydrogen phosphate.
| Compound Name | [(2R,5R)-5-(2,4-dioxopyrimidin-1-yl)-2-ethyl-4-methoxyoxolan-3-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 153213214 |
| Molecular Formula | C11H17N2O8P |
| Molecular Weight | 336.24 g/mol |
| Exact Mass | 336.07 |
| IUPAC Name | [(2R,5R)-5-(2,4-dioxopyrimidin-1-yl)-2-ethyl-4-methoxyoxolan-3-yl] dihydrogen phosphate |
| SMILES | CC[C@H]1O[C@@H](n2ccc(=O)[nH]c2=O)C(OC)C1OP(=O)(O)O |
| InChI | InChI=1S/C11H17N2O8P/c1-3-6-8(21-22(16,17)18)9(19-2)10(20-6)13-5-4-7(14)12-11(13)15/h4-6,8-10H,3H2,1-2H3,(H,12,14,15)(H2,16,17,18)/t6-,8?,9?,10-/m1/s1 |
| InChIKey | WMFAVNKDSDZUQE-UHMNONSZSA-N |
| XLogP | -0.66 |
| TPSA | 140.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.24 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|