C12H19B2N2O9P2+ — CID 88572292
CID 88572292 (PubChem CID 88572292) has the molecular formula C12H19B2N2O9P2+ and a molecular weight of 418.86 g/mol.
| Compound Name | CID 88572292 |
|---|---|
| PubChem CID | 88572292 |
| Molecular Formula | C12H19B2N2O9P2+ |
| Molecular Weight | 418.86 g/mol |
| Exact Mass | 419.07 |
| IUPAC Name | — |
| SMILES | [B][P+]([B])(C)OC[C@H]1O[C@@H](n2ccc(=O)[nH]c2=O)C(OC)[C@H]1OP(=O)(O)OC |
| InChI | InChI=1S/C12H19B2N2O9P2/c1-21-10-9(25-27(19,20)22-2)7(6-23-26(3,13)14)24-11(10)16-5-4-8(17)15-12(16)18/h4-5,7,9-11H,6H2,1-3H3,(H,19,20)(H,15,17,18)/q+1/t7-,9+,10?,11-/m1/s1 |
| InChIKey | YHUPCIVUNGPXCN-UPCPIJHOSA-N |
| XLogP | -0.67 |
| TPSA | 138.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.86 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|