C9H12BrN2O9P — CID 141357421
[bromo-[(2S,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl] dihydrogen phosphate (PubChem CID 141357421) has the molecular formula C9H12BrN2O9P and a molecular weight of 403.08 g/mol. Its IUPAC name is [bromo-[(2S,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl] dihydrogen phosphate.
| Compound Name | [bromo-[(2S,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 141357421 |
| Molecular Formula | C9H12BrN2O9P |
| Molecular Weight | 403.08 g/mol |
| Exact Mass | 401.95 |
| IUPAC Name | [bromo-[(2S,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl] dihydrogen phosphate |
| SMILES | O=c1ccn([C@@H]2O[C@H](C(Br)OP(=O)(O)O)[C@@H](O)[C@H]2O)c(=O)[nH]1 |
| InChI | InChI=1S/C9H12BrN2O9P/c10-7(21-22(17,18)19)6-4(14)5(15)8(20-6)12-2-1-3(13)11-9(12)16/h1-2,4-8,14-15H,(H,11,13,16)(H2,17,18,19)/t4-,5+,6-,7?,8+/m0/s1 |
| InChIKey | QKVHYUREDNRIOQ-RCYBNZJXSA-N |
| XLogP | -2.01 |
| TPSA | 171.31 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.08 |
| LogP ≤ 5 | -2.01 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|