C9H14IN2O15P3 — CID 175949831
[[[(2S,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]-iodomethoxy]-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 175949831) has the molecular formula C9H14IN2O15P3 and a molecular weight of 610.04 g/mol. Its IUPAC name is [[[(2S,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]-iodomethoxy]-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[[(2S,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]-iodomethoxy]-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 175949831 |
| Molecular Formula | C9H14IN2O15P3 |
| Molecular Weight | 610.04 g/mol |
| Exact Mass | 609.87 |
| IUPAC Name | [[[(2S,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]-iodomethoxy]-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | O=c1ccn([C@@H]2O[C@H](C(I)OP(=O)(O)OP(=O)(O)OP(=O)(O)O)[C@@H](O)[C@H]2O)c(=O)[nH]1 |
| InChI | InChI=1S/C9H14IN2O15P3/c10-7(25-29(20,21)27-30(22,23)26-28(17,18)19)6-4(14)5(15)8(24-6)12-2-1-3(13)11-9(12)16/h1-2,4-8,14-15H,(H,20,21)(H,22,23)(H,11,13,16)(H2,17,18,19)/t4-,5+,6-,7?,8+/m0/s1 |
| InChIKey | XJFACIUWEVVJFY-RCYBNZJXSA-N |
| XLogP | -1.74 |
| TPSA | 264.37 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.04 |
| LogP ≤ 5 | -1.74 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|