C12H20N3O15P3 — CID 123759268
[[2-amino-1-[(2S,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]but-3-enoxy]-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 123759268) has the molecular formula C12H20N3O15P3 and a molecular weight of 539.22 g/mol. Its IUPAC name is [[2-amino-1-[(2S,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]but-3-enoxy]-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[2-amino-1-[(2S,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]but-3-enoxy]-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 123759268 |
| Molecular Formula | C12H20N3O15P3 |
| Molecular Weight | 539.22 g/mol |
| Exact Mass | 539.01 |
| IUPAC Name | [[2-amino-1-[(2S,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]but-3-enoxy]-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | C=CC(N)C(OP(=O)(O)OP(=O)(O)OP(=O)(O)O)[C@H]1O[C@@H](n2ccc(=O)[nH]c2=O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C12H20N3O15P3/c1-2-5(13)9(28-32(23,24)30-33(25,26)29-31(20,21)22)10-7(17)8(18)11(27-10)15-4-3-6(16)14-12(15)19/h2-5,7-11,17-18H,1,13H2,(H,23,24)(H,25,26)(H,14,16,19)(H2,20,21,22)/t5?,7-,8+,9?,10-,11+/m0/s1 |
| InChIKey | FSKZOZRQEGLGIA-PHFWNMGQSA-N |
| XLogP | -2.62 |
| TPSA | 290.39 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.22 |
| LogP ≤ 5 | -2.62 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|