C15H22N2O18P2 — CID 91873333
[(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl (2S,3S,4S,5R)-3,4,5-trihydroxy-2-[hydroxy(phosphonooxy)phosphoryl]oxy-6-oxohexanoate (PubChem CID 91873333) has the molecular formula C15H22N2O18P2 and a molecular weight of 580.29 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl (2S,3S,4S,5R)-3,4,5-trihydroxy-2-[hydroxy(phosphonooxy)phosphoryl]oxy-6-oxohexanoate.
| Compound Name | [(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl (2S,3S,4S,5R)-3,4,5-trihydroxy-2-[hydroxy(phosphonooxy)phosphoryl]oxy-6-oxohexanoate |
|---|---|
| PubChem CID | 91873333 |
| Molecular Formula | C15H22N2O18P2 |
| Molecular Weight | 580.29 g/mol |
| Exact Mass | 580.03 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl (2S,3S,4S,5R)-3,4,5-trihydroxy-2-[hydroxy(phosphonooxy)phosphoryl]oxy-6-oxohexanoate |
| SMILES | O=C[C@H](O)[C@@H](O)[C@H](O)[C@H](OP(=O)(O)OP(=O)(O)O)C(=O)OC[C@H]1O[C@@H](n2ccc(=O)[nH]c2=O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C15H22N2O18P2/c18-3-5(19)8(21)10(23)12(34-37(30,31)35-36(27,28)29)14(25)32-4-6-9(22)11(24)13(33-6)17-2-1-7(20)16-15(17)26/h1-3,5-6,8-13,19,21-24H,4H2,(H,30,31)(H,16,20,26)(H2,27,28,29)/t5-,6+,8+,9+,10-,11+,12-,13+/m0/s1 |
| InChIKey | LRRVUQJIWMRFJW-CKKWFLRISA-N |
| XLogP | -5.42 |
| TPSA | 321.90 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.29 |
| LogP ≤ 5 | -5.42 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|