C15H24N2O19P2 — CID 22797839
[(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate;(2S,3S,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexanoic acid (PubChem CID 22797839) has the molecular formula C15H24N2O19P2 and a molecular weight of 598.30 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate;(2S,3S,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexanoic acid.
| Compound Name | [(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate;(2S,3S,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexanoic acid |
|---|---|
| PubChem CID | 22797839 |
| Molecular Formula | C15H24N2O19P2 |
| Molecular Weight | 598.30 g/mol |
| Exact Mass | 598.04 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate;(2S,3S,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexanoic acid |
| SMILES | O=C[C@H](O)[C@@H](O)[C@H](O)[C@H](O)C(=O)O.O=c1ccn([C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O)[C@@H](O)[C@H]2O)c(=O)[nH]1 |
| InChI | InChI=1S/C9H14N2O12P2.C6H10O7/c12-5-1-2-11(9(15)10-5)8-7(14)6(13)4(22-8)3-21-25(19,20)23-24(16,17)18;7-1-2(8)3(9)4(10)5(11)6(12)13/h1-2,4,6-8,13-14H,3H2,(H,19,20)(H,10,12,15)(H2,16,17,18);1-5,8-11H,(H,12,13)/t4-,6-,7-,8-;2-,3+,4-,5-/m10/s1 |
| InChIKey | GTUHFDVKVRTYTA-RNSSISKFSA-N |
| XLogP | -5.90 |
| TPSA | 353.13 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.30 |
| LogP ≤ 5 | -5.90 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|