C17H30N6O19P2 — CID 175439033
N-azidoacetamide;[(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate;2,3,4,5,6-pentahydroxyhexanal (PubChem CID 175439033) has the molecular formula C17H30N6O19P2 and a molecular weight of 684.40 g/mol. Its IUPAC name is N-azidoacetamide;[(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate;2,3,4,5,6-pentahydroxyhexanal.
| Compound Name | N-azidoacetamide;[(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate;2,3,4,5,6-pentahydroxyhexanal |
|---|---|
| PubChem CID | 175439033 |
| Molecular Formula | C17H30N6O19P2 |
| Molecular Weight | 684.40 g/mol |
| Exact Mass | 684.10 |
| IUPAC Name | N-azidoacetamide;[(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate;2,3,4,5,6-pentahydroxyhexanal |
| SMILES | CC(=O)NN=[N+]=[N-].O=CC(O)C(O)C(O)C(O)CO.O=c1ccn([C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O)[C@@H](O)[C@H]2O)c(=O)[nH]1 |
| InChI | InChI=1S/C9H14N2O12P2.C6H12O6.C2H4N4O/c12-5-1-2-11(9(15)10-5)8-7(14)6(13)4(22-8)3-21-25(19,20)23-24(16,17)18;7-1-3(9)5(11)6(12)4(10)2-8;1-2(7)4-6-5-3/h1-2,4,6-8,13-14H,3H2,(H,19,20)(H,10,12,15)(H2,16,17,18);1,3-6,8-12H,2H2;1H3,(H,4,7)/t4-,6-,7-,8-;;/m1../s1 |
| InChIKey | USGNQMYNYHKLCH-WFIJOQBCSA-N |
| XLogP | -5.65 |
| TPSA | 413.92 Ų |
| H-Bond Donors | 12 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.40 |
| LogP ≤ 5 | -5.65 |
| H-Bond Donors ≤ 5 | 12 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|