C17H28F3N3O18P2 — CID 175173534
[(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate;2,2,2-trifluoro-N-(2,3,4,5,6-pentahydroxyhexyl)acetamide (PubChem CID 175173534) has the molecular formula C17H28F3N3O18P2 and a molecular weight of 681.36 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate;2,2,2-trifluoro-N-(2,3,4,5,6-pentahydroxyhexyl)acetamide.
| Compound Name | [(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate;2,2,2-trifluoro-N-(2,3,4,5,6-pentahydroxyhexyl)acetamide |
|---|---|
| PubChem CID | 175173534 |
| Molecular Formula | C17H28F3N3O18P2 |
| Molecular Weight | 681.36 g/mol |
| Exact Mass | 681.08 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate;2,2,2-trifluoro-N-(2,3,4,5,6-pentahydroxyhexyl)acetamide |
| SMILES | O=C(NCC(O)C(O)C(O)C(O)CO)C(F)(F)F.O=c1ccn([C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O)[C@@H](O)[C@H]2O)c(=O)[nH]1 |
| InChI | InChI=1S/C9H14N2O12P2.C8H14F3NO6/c12-5-1-2-11(9(15)10-5)8-7(14)6(13)4(22-8)3-21-25(19,20)23-24(16,17)18;9-8(10,11)7(18)12-1-3(14)5(16)6(17)4(15)2-13/h1-2,4,6-8,13-14H,3H2,(H,19,20)(H,10,12,15)(H2,16,17,18);3-6,13-17H,1-2H2,(H,12,18)/t4-,6-,7-,8-;/m1./s1 |
| InChIKey | ZJLDKMOXQKFWFO-IAIGYFSYSA-N |
| XLogP | -5.52 |
| TPSA | 348.09 Ų |
| H-Bond Donors | 12 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.36 |
| LogP ≤ 5 | -5.52 |
| H-Bond Donors ≤ 5 | 12 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|