C15H30N2O25P4 — CID 175300620
1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione;phosphono dihydrogen phosphate;phosphono (3,4,5,6-tetrahydroxy-1-oxohexan-2-yl) hydrogen phosphate (PubChem CID 175300620) has the molecular formula C15H30N2O25P4 and a molecular weight of 762.29 g/mol. Its IUPAC name is 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione;phosphono dihydrogen phosphate;phosphono (3,4,5,6-tetrahydroxy-1-oxohexan-2-yl) hydrogen phosphate.
| Compound Name | 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione;phosphono dihydrogen phosphate;phosphono (3,4,5,6-tetrahydroxy-1-oxohexan-2-yl) hydrogen phosphate |
|---|---|
| PubChem CID | 175300620 |
| Molecular Formula | C15H30N2O25P4 |
| Molecular Weight | 762.29 g/mol |
| Exact Mass | 762.01 |
| IUPAC Name | 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione;phosphono dihydrogen phosphate;phosphono (3,4,5,6-tetrahydroxy-1-oxohexan-2-yl) hydrogen phosphate |
| SMILES | O=CC(OP(=O)(O)OP(=O)(O)O)C(O)C(O)C(O)CO.O=P(O)(O)OP(=O)(O)O.O=c1ccn([C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)c(=O)[nH]1 |
| InChI | InChI=1S/C9H12N2O6.C6H14O12P2.H4O7P2/c12-3-4-6(14)7(15)8(17-4)11-2-1-5(13)10-9(11)16;7-1-3(9)5(10)6(11)4(2-8)17-20(15,16)18-19(12,13)14;1-8(2,3)7-9(4,5)6/h1-2,4,6-8,12,14-15H,3H2,(H,10,13,16);2-7,9-11H,1H2,(H,15,16)(H2,12,13,14);(H2,1,2,3)(H2,4,5,6)/t4-,6-,7-,8-;;/m1../s1 |
| InChIKey | ZVEKLVIHRFJRAL-WFIJOQBCSA-N |
| XLogP | -6.81 |
| TPSA | 460.35 Ų |
| H-Bond Donors | 15 |
| H-Bond Acceptors | 19 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 762.29 |
| LogP ≤ 5 | -6.81 |
| H-Bond Donors ≤ 5 | 15 |
| H-Bond Acceptors ≤ 10 | 19 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|