C15H26N2O18P2 — CID 87279030
1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione;[(2R,3S,4S,5R)-2,3,4,5,6-pentahydroxyhexanoyl]-phosphonooxyphosphinic acid (PubChem CID 87279030) has the molecular formula C15H26N2O18P2 and a molecular weight of 584.32 g/mol. Its IUPAC name is 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione;[(2R,3S,4S,5R)-2,3,4,5,6-pentahydroxyhexanoyl]-phosphonooxyphosphinic acid.
| Compound Name | 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione;[(2R,3S,4S,5R)-2,3,4,5,6-pentahydroxyhexanoyl]-phosphonooxyphosphinic acid |
|---|---|
| PubChem CID | 87279030 |
| Molecular Formula | C15H26N2O18P2 |
| Molecular Weight | 584.32 g/mol |
| Exact Mass | 584.07 |
| IUPAC Name | 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione;[(2R,3S,4S,5R)-2,3,4,5,6-pentahydroxyhexanoyl]-phosphonooxyphosphinic acid |
| SMILES | O=C([C@H](O)[C@@H](O)[C@@H](O)[C@H](O)CO)P(=O)(O)OP(=O)(O)O.O=c1ccn([C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)c(=O)[nH]1 |
| InChI | InChI=1S/C9H12N2O6.C6H14O12P2/c12-3-4-6(14)7(15)8(17-4)11-2-1-5(13)10-9(11)16;7-1-2(8)3(9)4(10)5(11)6(12)19(13,14)18-20(15,16)17/h1-2,4,6-8,12,14-15H,3H2,(H,10,13,16);2-5,7-11H,1H2,(H,13,14)(H2,15,16,17)/t4-,6-,7-,8-;2-,3+,4+,5-/m11/s1 |
| InChIKey | BDARUPOQSSRKQF-YAGSFYHNSA-N |
| XLogP | -6.61 |
| TPSA | 347.06 Ų |
| H-Bond Donors | 12 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.32 |
| LogP ≤ 5 | -6.61 |
| H-Bond Donors ≤ 5 | 12 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|