C14H22N2O11 — CID 174406064
1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione;2,3,4,5-tetrahydroxypentanal (PubChem CID 174406064) has the molecular formula C14H22N2O11 and a molecular weight of 394.33 g/mol. Its IUPAC name is 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione;2,3,4,5-tetrahydroxypentanal.
| Compound Name | 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione;2,3,4,5-tetrahydroxypentanal |
|---|---|
| PubChem CID | 174406064 |
| Molecular Formula | C14H22N2O11 |
| Molecular Weight | 394.33 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione;2,3,4,5-tetrahydroxypentanal |
| SMILES | O=CC(O)C(O)C(O)CO.O=c1ccn([C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)c(=O)[nH]1 |
| InChI | InChI=1S/C9H12N2O6.C5H10O5/c12-3-4-6(14)7(15)8(17-4)11-2-1-5(13)10-9(11)16;6-1-3(8)5(10)4(9)2-7/h1-2,4,6-8,12,14-15H,3H2,(H,10,13,16);1,3-5,7-10H,2H2/t4-,6-,7-,8-;/m1./s1 |
| InChIKey | PNJPNHIQMLQSMC-IAIGYFSYSA-N |
| XLogP | -5.59 |
| TPSA | 222.77 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.33 |
| LogP ≤ 5 | -5.59 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|