C10H15N2O12P2+ — CID 91092008
[2-[(2R,5S)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]-2-oxo-1-phosphonoethyl]-trihydroxyphosphanium (PubChem CID 91092008) has the molecular formula C10H15N2O12P2+ and a molecular weight of 417.18 g/mol. Its IUPAC name is [2-[(2R,5S)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]-2-oxo-1-phosphonoethyl]-trihydroxyphosphanium.
| Compound Name | [2-[(2R,5S)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]-2-oxo-1-phosphonoethyl]-trihydroxyphosphanium |
|---|---|
| PubChem CID | 91092008 |
| Molecular Formula | C10H15N2O12P2+ |
| Molecular Weight | 417.18 g/mol |
| Exact Mass | 417.01 |
| IUPAC Name | [2-[(2R,5S)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]-2-oxo-1-phosphonoethyl]-trihydroxyphosphanium |
| SMILES | O=C(C(P(=O)(O)O)[P+](O)(O)O)[C@@H]1O[C@H](n2ccc(=O)[nH]c2=O)C(O)C1O |
| InChI | InChI=1S/C10H14N2O12P2/c13-3-1-2-12(10(17)11-3)8-5(15)4(14)7(24-8)6(16)9(25(18,19)20)26(21,22)23/h1-2,4-5,7-9,14-15,18-20H,(H2-,11,13,17,21,22,23)/p+1/t4?,5?,7-,8+,9?/m1/s1 |
| InChIKey | KBUVTWXZLQDUGV-AJSXINAISA-O |
| XLogP | -4.03 |
| TPSA | 239.84 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.18 |
| LogP ≤ 5 | -4.03 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|