C10H15N2O9P — CID 118604619
2-[5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]ethyl dihydrogen phosphate (PubChem CID 118604619) has the molecular formula C10H15N2O9P and a molecular weight of 338.21 g/mol. Its IUPAC name is 2-[5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]ethyl dihydrogen phosphate.
| Compound Name | 2-[5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]ethyl dihydrogen phosphate |
|---|---|
| PubChem CID | 118604619 |
| Molecular Formula | C10H15N2O9P |
| Molecular Weight | 338.21 g/mol |
| Exact Mass | 338.05 |
| IUPAC Name | 2-[5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]ethyl dihydrogen phosphate |
| SMILES | O=c1ccn(C2OC(CCOP(=O)(O)O)C(O)C2O)c(=O)[nH]1 |
| InChI | InChI=1S/C10H15N2O9P/c13-6-1-3-12(10(16)11-6)9-8(15)7(14)5(21-9)2-4-20-22(17,18)19/h1,3,5,7-9,14-15H,2,4H2,(H,11,13,16)(H2,17,18,19) |
| InChIKey | UAABJIHYGJWHFD-UHFFFAOYSA-N |
| XLogP | -2.34 |
| TPSA | 171.31 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.21 |
| LogP ≤ 5 | -2.34 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|